Products 2649788-90-7
CAS 2649788-90-7 appears in our catalog under these names: Methyl 4-bromo-3-chloro-2,5-difluorobenzoate, 98%, Methyl 4-bromo-3-chloro-2,5-difluorobenzoate, 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 500mg.
Methyl 4-bromo-3-chloro-2,5-difluorobenzoate (CAS 2649788-90-7) is a chemical compound with the molecular formula C8H4BrClF2O2 and a molecular weight of 285.47 g/mol. IUPAC name: methyl 4-bromo-3-chloro-2,5-difluorobenzoate. InChIKey: ZYCUBHIAODXYKG-UHFFFAOYSA-N.
| Molecular formula | C8H4BrClF2O2 |
|---|---|
| Molecular weight | 285.47 g/mol |
| IUPAC name | methyl 4-bromo-3-chloro-2,5-difluorobenzoate |
| InChIKey | ZYCUBHIAODXYKG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1F)Cl)Br)F |
Computed by PubChem (NCBI)