Products 2648588-79-6
CAS 2648588-79-6 is the registry number for tert-Butyl 3-bromo-5-(2-hydroxypropan-2-yl)benzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 3-bromo-5-(2-hydroxypropan-2-yl)benzoate (CAS 2648588-79-6) is a chemical compound with the molecular formula C14H19BrO3 and a molecular weight of 315.20 g/mol. IUPAC name: tert-butyl 3-bromo-5-(2-hydroxypropan-2-yl)benzoate. InChIKey: DEXAWADLQJQRHF-UHFFFAOYSA-N.
| Molecular formula | C14H19BrO3 |
|---|---|
| Molecular weight | 315.20 g/mol |
| IUPAC name | tert-butyl 3-bromo-5-(2-hydroxypropan-2-yl)benzoate |
| InChIKey | DEXAWADLQJQRHF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC(=CC(=C1)Br)C(C)(C)O |
Computed by PubChem (NCBI)