CAS 2760127-87-3 is the registry number for Ethyl 2-(4-bromo-2,6-dimethylphenoxy)-2-methylpropanoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-(4-bromo-2,6-dimethylphenoxy)-2-methylpropanoate (CAS 2760127-87-3) is a chemical compound with the molecular formula C14H19BrO3 and a molecular weight of 315.20 g/mol. IUPAC name: ethyl 2-(4-bromo-2,6-dimethylphenoxy)-2-methylpropanoate. InChIKey: HUNZKMQNOPZHMX-UHFFFAOYSA-N.
| Molecular formula | C14H19BrO3 |
|---|---|
| Molecular weight | 315.20 g/mol |
| IUPAC name | ethyl 2-(4-bromo-2,6-dimethylphenoxy)-2-methylpropanoate |
| InChIKey | HUNZKMQNOPZHMX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)(C)OC1=C(C=C(C=C1C)Br)C |
Computed by PubChem (NCBI)