CAS 26488-24-4 appears in our catalog under these names: Phenylalanyl-prolyl diketopiperazine, Cyclo(D-Phe-L-Pro). Offered by: Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, Get quote.
(3R,8aS)-3-benzyl-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione (CAS 26488-24-4) is a chemical compound with the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. IUPAC name: (3R,8aS)-3-benzyl-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione. InChIKey: QZBUWPVZSXDWSB-NEPJUHHUSA-N.
| Molecular formula | C14H16N2O2 |
|---|---|
| Molecular weight | 244.29 g/mol |
| IUPAC name | (3R,8aS)-3-benzyl-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
| InChIKey | QZBUWPVZSXDWSB-NEPJUHHUSA-N |
| SMILES | C1C[C@H]2C(=O)N[C@@H](C(=O)N2C1)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)