Products 264882-03-3
CAS 264882-03-3 is the registry number for Methyl 2-(3-bromophenyl)-2-diazoacetate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl 2-(3-bromophenyl)-2-diazoacetate (CAS 264882-03-3) is a chemical compound with the molecular formula C9H7BrN2O2 and a molecular weight of 255.07 g/mol. IUPAC name: methyl 2-(3-bromophenyl)-2-diazoacetate. InChIKey: FGDPJYRUOWEGAS-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O2 |
|---|---|
| Molecular weight | 255.07 g/mol |
| IUPAC name | methyl 2-(3-bromophenyl)-2-diazoacetate |
| InChIKey | FGDPJYRUOWEGAS-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=[N+]=[N-])C1=CC(=CC=C1)Br |
Computed by PubChem (NCBI)
Synonyms:
Methyl 2-(3-bromophenyl)-2-diazoacetate