CAS 26490-98-2 is the registry number for 1-Acetyl-5-iodo-1h-indol-3-yl acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(1-acetyl-5-iodoindol-3-yl) acetate (CAS 26490-98-2) is a chemical compound with the molecular formula C12H10INO3 and a molecular weight of 343.12 g/mol. IUPAC name: (1-acetyl-5-iodoindol-3-yl) acetate. InChIKey: XOGNTWBEKXNMPX-UHFFFAOYSA-N.
| Molecular formula | C12H10INO3 |
|---|---|
| Molecular weight | 343.12 g/mol |
| IUPAC name | (1-acetyl-5-iodoindol-3-yl) acetate |
| InChIKey | XOGNTWBEKXNMPX-UHFFFAOYSA-N |
| SMILES | CC(=O)N1C=C(C2=C1C=CC(=C2)I)OC(=O)C |
Computed by PubChem (NCBI)