Products 722-56-5
CAS 722-56-5 appears in our catalog under these names: Diphenyliodonium nitrate, Diphenyliodinium nitrate, Diphenyliodonium Nitrate. Offered by: GLPBio, Biosynth, TCI, Sigma-Aldrich, Fluorochem. Available pack sizes: 25g, 5g, 1kg, 1g.
Diphenyliodanium nitrate (CAS 722-56-5) is a chemical compound with the molecular formula C12H10INO3 and a molecular weight of 343.12 g/mol. IUPAC name: diphenyliodanium nitrate. InChIKey: CQZCVYWWRJDZBO-UHFFFAOYSA-N.
| Molecular formula | C12H10INO3 |
|---|---|
| Molecular weight | 343.12 g/mol |
| IUPAC name | diphenyliodanium nitrate |
| InChIKey | CQZCVYWWRJDZBO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)[I+]C2=CC=CC=C2.[N+](=O)([O-])[O-] |
Computed by PubChem (NCBI)