Products 2649575-19-7

CAS 2649575-19-7 appears in our catalog under these names: (Rac)–Upacicalcet, (Rac)-Upacicalcet, 95%, 95%, (Rac)-Upacicalcet, 95.0%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 5mg, 1mg, 5 mg, 10 mg.

Structural formula: {0} (CAS {1})

2-amino-3-[(3-chloro-2-methyl-5-sulfophenyl)carbamoylamino]propanoic acid (CAS 2649575-19-7) is a chemical compound with the molecular formula C11H14ClN3O6S and a molecular weight of 351.76 g/mol. IUPAC name: 2-amino-3-[(3-chloro-2-methyl-5-sulfophenyl)carbamoylamino]propanoic acid. InChIKey: LHEYGVSDVBEYQF-UHFFFAOYSA-N.

Identity
Molecular formulaC11H14ClN3O6S
Molecular weight351.76 g/mol
IUPAC name2-amino-3-[(3-chloro-2-methyl-5-sulfophenyl)carbamoylamino]propanoic acid
InChIKeyLHEYGVSDVBEYQF-UHFFFAOYSA-N
SMILESCC1=C(C=C(C=C1Cl)S(=O)(=O)O)NC(=O)NCC(C(=O)O)N

Computed by PubChem (NCBI)