CAS 2649575-19-7 appears in our catalog under these names: (Rac)–Upacicalcet, (Rac)-Upacicalcet, 95%, 95%, (Rac)-Upacicalcet, 95.0%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 5mg, 1mg, 5 mg, 10 mg.
2-amino-3-[(3-chloro-2-methyl-5-sulfophenyl)carbamoylamino]propanoic acid (CAS 2649575-19-7) is a chemical compound with the molecular formula C11H14ClN3O6S and a molecular weight of 351.76 g/mol. IUPAC name: 2-amino-3-[(3-chloro-2-methyl-5-sulfophenyl)carbamoylamino]propanoic acid. InChIKey: LHEYGVSDVBEYQF-UHFFFAOYSA-N.
| Molecular formula | C11H14ClN3O6S |
|---|---|
| Molecular weight | 351.76 g/mol |
| IUPAC name | 2-amino-3-[(3-chloro-2-methyl-5-sulfophenyl)carbamoylamino]propanoic acid |
| InChIKey | LHEYGVSDVBEYQF-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1Cl)S(=O)(=O)O)NC(=O)NCC(C(=O)O)N |
Computed by PubChem (NCBI)