CAS 265119-94-6 appears in our catalog under these names: (2,2-Dimethyl-2,3-dihydro-benzofuran-7-yloxy)-acetic acid, 95%, 2-((2,2-Dimethyl-2,3-dihydrobenzofuran-7-yl)oxy)acetic acid, 97%, (2,2-Dimethyl-2,3-dihydro-benzofuran-7-yloxy)-acetic acid, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 1g, 100mg.
2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]acetic acid (CAS 265119-94-6) is a chemical compound with the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. IUPAC name: 2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]acetic acid. InChIKey: BDCGKUGCTFTPLS-UHFFFAOYSA-N.
| Molecular formula | C12H14O4 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | 2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]acetic acid |
| InChIKey | BDCGKUGCTFTPLS-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(O1)C(=CC=C2)OCC(=O)O)C |
Computed by PubChem (NCBI)