Products 2651996-55-1
CAS 2651996-55-1 is the registry number for (2-(2,6-Dioxopiperidin-3-yl)-3-oxoisoindolin-4-yl)glycine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-4-yl]amino]acetic acid (CAS 2651996-55-1) is a chemical compound with the molecular formula C15H15N3O5 and a molecular weight of 317.30 g/mol. IUPAC name: 2-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-4-yl]amino]acetic acid. InChIKey: QZTSIINAARXFSY-UHFFFAOYSA-N.
| Molecular formula | C15H15N3O5 |
|---|---|
| Molecular weight | 317.30 g/mol |
| IUPAC name | 2-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-4-yl]amino]acetic acid |
| InChIKey | QZTSIINAARXFSY-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2CC3=C(C2=O)C(=CC=C3)NCC(=O)O |
Computed by PubChem (NCBI)