CAS 390367-50-7 appears in our catalog under these names: 3-(2-Aminoethoxy) Thalidomide, Thalidomide-4-O-C2-NH2 95%, Thalidomide-4-O-C2-NH2. Offered by: TRC, Ambeed, MedChemExpress. Available pack sizes: 250mg, 100mg, 1g, Get quote.
4-(2-aminoethoxy)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (CAS 390367-50-7) is a chemical compound with the molecular formula C15H15N3O5 and a molecular weight of 317.30 g/mol. IUPAC name: 4-(2-aminoethoxy)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione. InChIKey: AXEKUDWMPOBTMQ-UHFFFAOYSA-N.
| Molecular formula | C15H15N3O5 |
|---|---|
| Molecular weight | 317.30 g/mol |
| IUPAC name | 4-(2-aminoethoxy)-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| InChIKey | AXEKUDWMPOBTMQ-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C(=CC=C3)OCCN |
Computed by PubChem (NCBI)