CAS 26525-25-7 appears in our catalog under these names: 1-(1-Adamantyl)-2,2-dibromoethanone, 95%, 1-(Adamantan-1-yl)-2,2-dibromoethanone, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
1-(1-adamantyl)-2,2-dibromoethanone (CAS 26525-25-7) is a chemical compound with the molecular formula C12H16Br2O and a molecular weight of 336.06 g/mol. IUPAC name: 1-(1-adamantyl)-2,2-dibromoethanone. InChIKey: XDJXVMSXFQUDGZ-UHFFFAOYSA-N.
| Molecular formula | C12H16Br2O |
|---|---|
| Molecular weight | 336.06 g/mol |
| IUPAC name | 1-(1-adamantyl)-2,2-dibromoethanone |
| InChIKey | XDJXVMSXFQUDGZ-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)C(=O)C(Br)Br |
Computed by PubChem (NCBI)