Products 2734775-26-7
CAS 2734775-26-7 is the registry number for 1,5-Dibromo-3-(1,1-dimethylethyl)-2-ethoxybenzene, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
1,5-dibromo-3-tert-butyl-2-ethoxybenzene (CAS 2734775-26-7) is a chemical compound with the molecular formula C12H16Br2O and a molecular weight of 336.06 g/mol. IUPAC name: 1,5-dibromo-3-tert-butyl-2-ethoxybenzene. InChIKey: GQFVIBBCZURNKS-UHFFFAOYSA-N.
| Molecular formula | C12H16Br2O |
|---|---|
| Molecular weight | 336.06 g/mol |
| IUPAC name | 1,5-dibromo-3-tert-butyl-2-ethoxybenzene |
| InChIKey | GQFVIBBCZURNKS-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1Br)Br)C(C)(C)C |
Computed by PubChem (NCBI)