CAS 2655597-20-7 is the registry number for tert-Butyl (1S,4S)-5-acetyl-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Tert-butyl (1S,4S)-5-acetyl-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate (CAS 2655597-20-7) is a chemical compound with the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. IUPAC name: tert-butyl (1S,4S)-5-acetyl-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate. InChIKey: IDBIXMCSQSWEAR-UWVGGRQHSA-N.
| Molecular formula | C12H20N2O3 |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | tert-butyl (1S,4S)-5-acetyl-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate |
| InChIKey | IDBIXMCSQSWEAR-UWVGGRQHSA-N |
| SMILES | CC(=O)N1C[C@@H]2C[C@H]1CN2C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)