Products 26560-53-2
CAS 26560-53-2 is the registry number for tert-Butyl glycyl-L-valinate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl (2S)-2-[(2-aminoacetyl)amino]-3-methylbutanoate (CAS 26560-53-2) is a chemical compound with the molecular formula C11H22N2O3 and a molecular weight of 230.30 g/mol. IUPAC name: tert-butyl (2S)-2-[(2-aminoacetyl)amino]-3-methylbutanoate. InChIKey: DEKLUYPXEBUVDV-VIFPVBQESA-N.
| Molecular formula | C11H22N2O3 |
|---|---|
| Molecular weight | 230.30 g/mol |
| IUPAC name | tert-butyl (2S)-2-[(2-aminoacetyl)amino]-3-methylbutanoate |
| InChIKey | DEKLUYPXEBUVDV-VIFPVBQESA-N |
| SMILES | CC(C)[C@@H](C(=O)OC(C)(C)C)NC(=O)CN |
Computed by PubChem (NCBI)
Synonyms:
tert-butyl glycyl-L-valinate