CAS 870849-49-3 appears in our catalog under these names: 2-(2-Fluorophenyl)-2-methylpropanoic acid, 98%, 2-(2-Fluoro-phenyl)-2-methyl-propionic acid, 2-(2-Fluorophenyl)-2-methylpropanoic acid 98%, Benzeneacetic acid, 2-fluoro-α,α-dimethyl-, 98%, 98%, 2-(2-Fluorophenyl)-2-methylpropionic acid, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g, 250mg, 100mg.
2-(2-fluorophenyl)-2-methylpropanoic acid (CAS 870849-49-3) is a chemical compound with the molecular formula C10H11FO2 and a molecular weight of 182.19 g/mol. IUPAC name: 2-(2-fluorophenyl)-2-methylpropanoic acid. InChIKey: DCCIKELFJWXVFL-UHFFFAOYSA-N.
| Molecular formula | C10H11FO2 |
|---|---|
| Molecular weight | 182.19 g/mol |
| IUPAC name | 2-(2-fluorophenyl)-2-methylpropanoic acid |
| InChIKey | DCCIKELFJWXVFL-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=CC=C1F)C(=O)O |
Computed by PubChem (NCBI)