CAS 26586-27-6 appears in our catalog under these names: 3–Amino–4–(piperidin–1–yl)benzoic acid, 3-Amino-4-piperidin-1-yl-benzoic acid, 3-Amino-4-(piperidin-1-yl)benzoic acid, 95%. Offered by: GLPBio, Biosynth, Ambeed. Available pack sizes: 1g, 250mg, 5g, 2,5g.
3-amino-4-piperidin-1-ylbenzoic acid (CAS 26586-27-6) is a chemical compound with the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. IUPAC name: 3-amino-4-piperidin-1-ylbenzoic acid. InChIKey: DFGNBCGBUAHIPC-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O2 |
|---|---|
| Molecular weight | 220.27 g/mol |
| IUPAC name | 3-amino-4-piperidin-1-ylbenzoic acid |
| InChIKey | DFGNBCGBUAHIPC-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C2=C(C=C(C=C2)C(=O)O)N |
Computed by PubChem (NCBI)