Products 2659308-41-3
CAS 2659308-41-3 is the registry number for MMB–4en–PINACA. Offered by: GLPBio. Available pack sizes: 1mg, 5mg.
Methyl (2S)-3-methyl-2-[(1-pent-4-enylindazole-3-carbonyl)amino]butanoate (CAS 2659308-41-3) is a chemical compound with the molecular formula C19H25N3O3 and a molecular weight of 343.4 g/mol. IUPAC name: methyl (2S)-3-methyl-2-[(1-pent-4-enylindazole-3-carbonyl)amino]butanoate. InChIKey: UJELURFNWPRFMM-INIZCTEOSA-N.
| Molecular formula | C19H25N3O3 |
|---|---|
| Molecular weight | 343.4 g/mol |
| IUPAC name | methyl (2S)-3-methyl-2-[(1-pent-4-enylindazole-3-carbonyl)amino]butanoate |
| InChIKey | UJELURFNWPRFMM-INIZCTEOSA-N |
| SMILES | CC(C)[C@@H](C(=O)OC)NC(=O)C1=NN(C2=CC=CC=C21)CCCC=C |
Computed by PubChem (NCBI)