Products 960122-89-8

CAS 960122-89-8 is the registry number for Methyl 3-(4-Cyano-4-(N-phenylpropionamido)piperidin-1-yl)propanoate. Offered by: TRC. Available pack sizes: 100mg, 10mg, 50mg.

Structural formula: {0} (CAS {1})

Methyl 3-[4-cyano-4-(N-propanoylanilino)piperidin-1-yl]propanoate (CAS 960122-89-8) is a chemical compound with the molecular formula C19H25N3O3 and a molecular weight of 343.4 g/mol. IUPAC name: methyl 3-[4-cyano-4-(N-propanoylanilino)piperidin-1-yl]propanoate. InChIKey: PGEZTXRONZJYPB-UHFFFAOYSA-N.

Identity
Molecular formulaC19H25N3O3
Molecular weight343.4 g/mol
IUPAC namemethyl 3-[4-cyano-4-(N-propanoylanilino)piperidin-1-yl]propanoate
InChIKeyPGEZTXRONZJYPB-UHFFFAOYSA-N
SMILESCCC(=O)N(C1=CC=CC=C1)C2(CCN(CC2)CCC(=O)OC)C#N

Computed by PubChem (NCBI)