CAS 26626-89-1 appears in our catalog under these names: (3S,8aS)-3-Propylhexahydropyrrolo(1,2-a)pyrazine-1,4-dione, 97%, (3S,8aS)-3-Propyl-octahydropyrrolo(1,2-a)pyrazine-1,4-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
(3S,8aS)-3-propyl-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione (CAS 26626-89-1) is a chemical compound with the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. IUPAC name: (3S,8aS)-3-propyl-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione. InChIKey: XHSJAENZJRHKAH-YUMQZZPRSA-N.
| Molecular formula | C10H16N2O2 |
|---|---|
| Molecular weight | 196.25 g/mol |
| IUPAC name | (3S,8aS)-3-propyl-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
| InChIKey | XHSJAENZJRHKAH-YUMQZZPRSA-N |
| SMILES | CCC[C@H]1C(=O)N2CCC[C@H]2C(=O)N1 |
Computed by PubChem (NCBI)