CAS 266312-58-7 is the registry number for 5-(2,4-Dichlorophenyl)-4-(furan-2-ylmethyl)-4H-1,2,4-triazole-3-thiol. Offered by: Biosynth. Available pack sizes: 2,5g.
3-(2,4-dichlorophenyl)-4-(furan-2-ylmethyl)-1H-1,2,4-triazole-5-thione (CAS 266312-58-7) is a chemical compound with the molecular formula C13H9Cl2N3OS and a molecular weight of 326.2 g/mol. IUPAC name: 3-(2,4-dichlorophenyl)-4-(furan-2-ylmethyl)-1H-1,2,4-triazole-5-thione. InChIKey: SJNKYBFZSVMFGR-UHFFFAOYSA-N.
| Molecular formula | C13H9Cl2N3OS |
|---|---|
| Molecular weight | 326.2 g/mol |
| IUPAC name | 3-(2,4-dichlorophenyl)-4-(furan-2-ylmethyl)-1H-1,2,4-triazole-5-thione |
| InChIKey | SJNKYBFZSVMFGR-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)CN2C(=NNC2=S)C3=C(C=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)