CAS 683274-66-0 is the registry number for 4-(2-Amino-4-thiazolyl)-3-(2,4-dichlorophenyl)-5-methylisoxazole, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
4-[3-(2,4-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]-1,3-thiazol-2-amine (CAS 683274-66-0) is a chemical compound with the molecular formula C13H9Cl2N3OS and a molecular weight of 326.2 g/mol. IUPAC name: 4-[3-(2,4-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]-1,3-thiazol-2-amine. InChIKey: GKPYYVCBCOKUPT-UHFFFAOYSA-N.
| Molecular formula | C13H9Cl2N3OS |
|---|---|
| Molecular weight | 326.2 g/mol |
| IUPAC name | 4-[3-(2,4-dichlorophenyl)-5-methyl-1,2-oxazol-4-yl]-1,3-thiazol-2-amine |
| InChIKey | GKPYYVCBCOKUPT-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=C(C=C(C=C2)Cl)Cl)C3=CSC(=N3)N |
Computed by PubChem (NCBI)