CAS 2667596-78-1 is the registry number for (S)-7-Amino-9-fluoro-2-(1-methoxyethyl)-4H-pyrido[1,2-a]pyrimidin-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-amino-9-fluoro-2-[(1S)-1-methoxyethyl]pyrido[1,2-a]pyrimidin-4-one (CAS 2667596-78-1) is a chemical compound with the molecular formula C11H12FN3O2 and a molecular weight of 237.23 g/mol. IUPAC name: 7-amino-9-fluoro-2-[(1S)-1-methoxyethyl]pyrido[1,2-a]pyrimidin-4-one. InChIKey: WEUKJTYOQWYOAV-LURJTMIESA-N.
| Molecular formula | C11H12FN3O2 |
|---|---|
| Molecular weight | 237.23 g/mol |
| IUPAC name | 7-amino-9-fluoro-2-[(1S)-1-methoxyethyl]pyrido[1,2-a]pyrimidin-4-one |
| InChIKey | WEUKJTYOQWYOAV-LURJTMIESA-N |
| SMILES | C[C@@H](C1=CC(=O)N2C=C(C=C(C2=N1)F)N)OC |
Computed by PubChem (NCBI)