Products 669696-68-8
CAS 669696-68-8 is the registry number for 1-(4-Fluorophenyl)-5-oxopyrrolidine-3-carbohydrazide, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 100g, 25g.
1-(4-fluorophenyl)-5-oxopyrrolidine-3-carbohydrazide (CAS 669696-68-8) is a chemical compound with the molecular formula C11H12FN3O2 and a molecular weight of 237.23 g/mol. IUPAC name: 1-(4-fluorophenyl)-5-oxopyrrolidine-3-carbohydrazide. InChIKey: WPTJFEMVIBPOQD-UHFFFAOYSA-N.
| Molecular formula | C11H12FN3O2 |
|---|---|
| Molecular weight | 237.23 g/mol |
| IUPAC name | 1-(4-fluorophenyl)-5-oxopyrrolidine-3-carbohydrazide |
| InChIKey | WPTJFEMVIBPOQD-UHFFFAOYSA-N |
| SMILES | C1C(CN(C1=O)C2=CC=C(C=C2)F)C(=O)NN |
Computed by PubChem (NCBI)