Products 2667654-53-5
CAS 2667654-53-5 is the registry number for tert-Butyl 2-((2S,4R)-4-hydroxypiperidin-2-yl)acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 2-[(2S,4R)-4-hydroxypiperidin-2-yl]acetate (CAS 2667654-53-5) is a chemical compound with the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. IUPAC name: tert-butyl 2-[(2S,4R)-4-hydroxypiperidin-2-yl]acetate. InChIKey: BYMYUZPAXPMZGY-DTWKUNHWSA-N.
| Molecular formula | C11H21NO3 |
|---|---|
| Molecular weight | 215.29 g/mol |
| IUPAC name | tert-butyl 2-[(2S,4R)-4-hydroxypiperidin-2-yl]acetate |
| InChIKey | BYMYUZPAXPMZGY-DTWKUNHWSA-N |
| SMILES | CC(C)(C)OC(=O)C[C@@H]1C[C@@H](CCN1)O |
Computed by PubChem (NCBI)