Products 2667654-54-6
CAS 2667654-54-6 is the registry number for tert-Butyl 2-((2R,4R)-4-hydroxypiperidin-2-yl)acetate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 2-[(2R,4R)-4-hydroxypiperidin-2-yl]acetate (CAS 2667654-54-6) is a chemical compound with the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. IUPAC name: tert-butyl 2-[(2R,4R)-4-hydroxypiperidin-2-yl]acetate. InChIKey: BYMYUZPAXPMZGY-RKDXNWHRSA-N.
| Molecular formula | C11H21NO3 |
|---|---|
| Molecular weight | 215.29 g/mol |
| IUPAC name | tert-butyl 2-[(2R,4R)-4-hydroxypiperidin-2-yl]acetate |
| InChIKey | BYMYUZPAXPMZGY-RKDXNWHRSA-N |
| SMILES | CC(C)(C)OC(=O)C[C@H]1C[C@@H](CCN1)O |
Computed by PubChem (NCBI)