CAS 26699-00-3 appears in our catalog under these names: N-Carbobenzoxy-l-isoleucine dicyclohexylammonium salt, 97%, N–Benzyloxycarbonyl–L–isoleucine dicyclohexylamine salt, Z-L-Ile-OH*DCHA, N-Carbobenzoxy-L-isoleucine Dicyclohexylammonium Salt, >98.0%(HPLC)(T), Z-Ile-OH·DCHA 98%. Offered by: Combi-blocks, GLPBio, Iris Biotech, TCI, Ambeed. Available pack sizes: 100g, 1kg, 500g, 25g, 5g, 1g.
N-cyclohexylcyclohexanamine;(2S,3S)-3-methyl-2-(phenylmethoxycarbonylamino)pentanoic acid (CAS 26699-00-3) is a chemical compound with the molecular formula C26H42N2O4 and a molecular weight of 446.6 g/mol. IUPAC name: N-cyclohexylcyclohexanamine;(2S,3S)-3-methyl-2-(phenylmethoxycarbonylamino)pentanoic acid. InChIKey: QWMHUFMEYKIYPC-JGAZGGJJSA-N.
| Molecular formula | C26H42N2O4 |
|---|---|
| Molecular weight | 446.6 g/mol |
| IUPAC name | N-cyclohexylcyclohexanamine;(2S,3S)-3-methyl-2-(phenylmethoxycarbonylamino)pentanoic acid |
| InChIKey | QWMHUFMEYKIYPC-JGAZGGJJSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)O)NC(=O)OCC1=CC=CC=C1.C1CCC(CC1)NC2CCCCC2 |
Computed by PubChem (NCBI)