CAS 53363-87-4 appears in our catalog under these names: Z–Leu–OH·DCHA, Cbz-Leu-OH·DCHA 95%, Z-Leu-OH.DCHA, 98%, 98%, Z-Leu-OH.DCHA, 99.85%, Z-Leu-OH.DCHA, 98%. Offered by: GLPBio, Ambeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100g, 250g, 25g, 500g, 50g, 25 g, 50 g.
N-cyclohexylcyclohexanamine;(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoic acid (CAS 53363-87-4) is a chemical compound with the molecular formula C26H42N2O4 and a molecular weight of 446.6 g/mol. IUPAC name: N-cyclohexylcyclohexanamine;(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoic acid. InChIKey: FOULZFSGIVQTHX-YDALLXLXSA-N.
| Molecular formula | C26H42N2O4 |
|---|---|
| Molecular weight | 446.6 g/mol |
| IUPAC name | N-cyclohexylcyclohexanamine;(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoic acid |
| InChIKey | FOULZFSGIVQTHX-YDALLXLXSA-N |
| SMILES | CC(C)C[C@@H](C(=O)O)NC(=O)OCC1=CC=CC=C1.C1CCC(CC1)NC2CCCCC2 |
Computed by PubChem (NCBI)