CAS 2669971-68-8 is the registry number for Oxide-DFHBI-demethyl. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[(3,5-difluoro-4-hydroxyphenyl)methylidene]-2-methyl-1,3-oxazol-5-one (CAS 2669971-68-8) is a chemical compound with the molecular formula C11H7F2NO3 and a molecular weight of 239.17 g/mol. IUPAC name: 4-[(3,5-difluoro-4-hydroxyphenyl)methylidene]-2-methyl-1,3-oxazol-5-one. InChIKey: OZFQWFUNWCFZQU-UHFFFAOYSA-N.
| Molecular formula | C11H7F2NO3 |
|---|---|
| Molecular weight | 239.17 g/mol |
| IUPAC name | 4-[(3,5-difluoro-4-hydroxyphenyl)methylidene]-2-methyl-1,3-oxazol-5-one |
| InChIKey | OZFQWFUNWCFZQU-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CC2=CC(=C(C(=C2)F)O)F)C(=O)O1 |
Computed by PubChem (NCBI)