CAS 267-58-3 appears in our catalog under these names: Benzo[1,2-b,4,5-b']difuran, >98.0%(GC), Benzo[1,2-b:4,5-b']difuran. Offered by: TCI, Chemat. Available pack sizes: 1g, 50mg, 250mg.
Furo[2,3-f][1]benzofuran (CAS 267-58-3) is a chemical compound with the molecular formula C10H6O2 and a molecular weight of 158.15 g/mol. IUPAC name: furo[2,3-f][1]benzofuran. InChIKey: MCNFETJREUYKBJ-UHFFFAOYSA-N.
| Molecular formula | C10H6O2 |
|---|---|
| Molecular weight | 158.15 g/mol |
| IUPAC name | furo[2,3-f][1]benzofuran |
| InChIKey | MCNFETJREUYKBJ-UHFFFAOYSA-N |
| SMILES | C1=COC2=CC3=C(C=C21)OC=C3 |
Computed by PubChem (NCBI)