CAS 613-20-7 is the registry number for 2,6-Naphthoquinone. Offered by: Chemat Brand. Available pack sizes: on request.
Naphthalene-2,6-dione (CAS 613-20-7) is a chemical compound with the molecular formula C10H6O2 and a molecular weight of 158.15 g/mol. IUPAC name: naphthalene-2,6-dione. InChIKey: SLBHRPOLVUEFSG-UHFFFAOYSA-N.
| Molecular formula | C10H6O2 |
|---|---|
| Molecular weight | 158.15 g/mol |
| IUPAC name | naphthalene-2,6-dione |
| InChIKey | SLBHRPOLVUEFSG-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)C=C2C1=CC(=O)C=C2 |
Computed by PubChem (NCBI)