CAS 26707-09-5 appears in our catalog under these names: 4,4',4''-Phosphanetriyltriphenol, 95%, 95%, TRIS(4-HYDROXY-PHENYL)PHOSPHINE, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-bis(4-hydroxyphenyl)phosphanylphenol (CAS 26707-09-5) is a chemical compound with the molecular formula C18H15O3P and a molecular weight of 310.3 g/mol. IUPAC name: 4-bis(4-hydroxyphenyl)phosphanylphenol. InChIKey: IOHRTWBJHOLWRQ-UHFFFAOYSA-N.
| Molecular formula | C18H15O3P |
|---|---|
| Molecular weight | 310.3 g/mol |
| IUPAC name | 4-bis(4-hydroxyphenyl)phosphanylphenol |
| InChIKey | IOHRTWBJHOLWRQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1O)P(C2=CC=C(C=C2)O)C3=CC=C(C=C3)O |
Computed by PubChem (NCBI)