Products 26725-50-8

CAS 26725-50-8 is the registry number for Benzotriazole-4-sulfonic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2H-benzotriazole-4-sulfonic acid (CAS 26725-50-8) is a chemical compound with the molecular formula C6H5N3O3S and a molecular weight of 199.19 g/mol. IUPAC name: 2H-benzotriazole-4-sulfonic acid. InChIKey: WVKWKEWFTVEVCF-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5N3O3S
Molecular weight199.19 g/mol
IUPAC name2H-benzotriazole-4-sulfonic acid
InChIKeyWVKWKEWFTVEVCF-UHFFFAOYSA-N
SMILESC1=CC2=NNN=C2C(=C1)S(=O)(=O)O

Computed by PubChem (NCBI)