CAS 91160-06-4 is the registry number for 1H-Imidazo[4,5-b]pyridine-6-sulfonic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1H-imidazo[4,5-b]pyridine-6-sulfonic acid (CAS 91160-06-4) is a chemical compound with the molecular formula C6H5N3O3S and a molecular weight of 199.19 g/mol. IUPAC name: 1H-imidazo[4,5-b]pyridine-6-sulfonic acid. InChIKey: UQTVQJWEUXMWOS-UHFFFAOYSA-N.
| Molecular formula | C6H5N3O3S |
|---|---|
| Molecular weight | 199.19 g/mol |
| IUPAC name | 1H-imidazo[4,5-b]pyridine-6-sulfonic acid |
| InChIKey | UQTVQJWEUXMWOS-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1NC=N2)S(=O)(=O)O |
Computed by PubChem (NCBI)