CAS 2676180-55-3 is the registry number for (3S,4R)-6-Benzyl-3-methyl-1,6-diazaspiro[3.4]octan-5-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S,4R)-7-benzyl-3-methyl-1,7-diazaspiro[3.4]octan-8-one (CAS 2676180-55-3) is a chemical compound with the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. IUPAC name: (3S,4R)-7-benzyl-3-methyl-1,7-diazaspiro[3.4]octan-8-one. InChIKey: MGAOZNYIYBYWEI-SMDDNHRTSA-N.
| Molecular formula | C14H18N2O |
|---|---|
| Molecular weight | 230.31 g/mol |
| IUPAC name | (3S,4R)-7-benzyl-3-methyl-1,7-diazaspiro[3.4]octan-8-one |
| InChIKey | MGAOZNYIYBYWEI-SMDDNHRTSA-N |
| SMILES | C[C@H]1CN[C@]12CCN(C2=O)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)