Products 2676865-58-8
CAS 2676865-58-8 is the registry number for 6-Fluoro-4-nitro-2,3-dihydro-1H-inden-5-ol, 97%. Offered by: Ambeed, BLDpharm, Chemat. Available pack sizes: 250mg, 1g, 100mg.
6-fluoro-4-nitro-2,3-dihydro-1H-inden-5-ol (CAS 2676865-58-8) is a chemical compound with the molecular formula C9H8FNO3 and a molecular weight of 197.16 g/mol. IUPAC name: 6-fluoro-4-nitro-2,3-dihydro-1H-inden-5-ol. InChIKey: RVLZJXALQVGIDO-UHFFFAOYSA-N.
| Molecular formula | C9H8FNO3 |
|---|---|
| Molecular weight | 197.16 g/mol |
| IUPAC name | 6-fluoro-4-nitro-2,3-dihydro-1H-inden-5-ol |
| InChIKey | RVLZJXALQVGIDO-UHFFFAOYSA-N |
| SMILES | C1CC2=CC(=C(C(=C2C1)[N+](=O)[O-])O)F |
Computed by PubChem (NCBI)