CAS 26774-88-9 appears in our catalog under these names: (R)-(-)-2-(2,5-DIHYDROPHENYL)GLYCINE, 9&, Cefradine Impurity 7, Cefradine EP Impurity B, (R)-(-)-2-(2,5-Dihydrophenyl)glycine, D–(–)–2–(2,5–Dihydrophenyl)glycine. Offered by: Sigma-Aldrich, Chemat Brand, TRC, GLPBio, TCI. Available pack sizes: 5G, on request, 100g, 25g, 500g, 1EA, Get quote, 1g.
(2R)-2-amino-2-cyclohexa-1,4-dien-1-ylacetic acid (CAS 26774-88-9) is a chemical compound with the molecular formula C8H11NO2 and a molecular weight of 153.18 g/mol. IUPAC name: (2R)-2-amino-2-cyclohexa-1,4-dien-1-ylacetic acid. InChIKey: JBJJTCGQCRGNOL-SSDOTTSWSA-N.
| Molecular formula | C8H11NO2 |
|---|---|
| Molecular weight | 153.18 g/mol |
| IUPAC name | (2R)-2-amino-2-cyclohexa-1,4-dien-1-ylacetic acid |
| InChIKey | JBJJTCGQCRGNOL-SSDOTTSWSA-N |
| SMILES | C1C=CCC(=C1)[C@H](C(=O)O)N |
Computed by PubChem (NCBI)