Products 2677884-19-2
CAS 2677884-19-2 is the registry number for tert-Butyl 7-(difluoromethyl)-3,4-dihydroisoquinoline-2(1H)-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 7-(difluoromethyl)-3,4-dihydro-1H-isoquinoline-2-carboxylate (CAS 2677884-19-2) is a chemical compound with the molecular formula C15H19F2NO2 and a molecular weight of 283.31 g/mol. IUPAC name: tert-butyl 7-(difluoromethyl)-3,4-dihydro-1H-isoquinoline-2-carboxylate. InChIKey: JMIDGRDZBHBKMS-UHFFFAOYSA-N.
| Molecular formula | C15H19F2NO2 |
|---|---|
| Molecular weight | 283.31 g/mol |
| IUPAC name | tert-butyl 7-(difluoromethyl)-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| InChIKey | JMIDGRDZBHBKMS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C1)C=C(C=C2)C(F)F |
Computed by PubChem (NCBI)