CAS 455957-95-6 is the registry number for rac-(3R,4S)-1-tert-butyl-4-(2,4-difluorophenyl)pyrrolidine-3-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
(3R,4S)-1-tert-butyl-4-(2,4-difluorophenyl)pyrrolidine-3-carboxylic acid (CAS 455957-95-6) is a chemical compound with the molecular formula C15H19F2NO2 and a molecular weight of 283.31 g/mol. IUPAC name: (3R,4S)-1-tert-butyl-4-(2,4-difluorophenyl)pyrrolidine-3-carboxylic acid. InChIKey: VREKTDQOMSTPDN-NEPJUHHUSA-N.
| Molecular formula | C15H19F2NO2 |
|---|---|
| Molecular weight | 283.31 g/mol |
| IUPAC name | (3R,4S)-1-tert-butyl-4-(2,4-difluorophenyl)pyrrolidine-3-carboxylic acid |
| InChIKey | VREKTDQOMSTPDN-NEPJUHHUSA-N |
| SMILES | CC(C)(C)N1C[C@@H]([C@H](C1)C(=O)O)C2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)