CAS 267880-92-2 is the registry number for 3–(4–Bromo–2–Fluorophenyl)–3–Oxopropanenitrile. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
3-(4-bromo-2-fluorophenyl)-3-oxopropanenitrile (CAS 267880-92-2) is a chemical compound with the molecular formula C9H5BrFNO and a molecular weight of 242.04 g/mol. IUPAC name: 3-(4-bromo-2-fluorophenyl)-3-oxopropanenitrile. InChIKey: JYQGDFCINOSMOC-UHFFFAOYSA-N.
| Molecular formula | C9H5BrFNO |
|---|---|
| Molecular weight | 242.04 g/mol |
| IUPAC name | 3-(4-bromo-2-fluorophenyl)-3-oxopropanenitrile |
| InChIKey | JYQGDFCINOSMOC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)F)C(=O)CC#N |
Computed by PubChem (NCBI)