CAS 268-77-9 appears in our catalog under these names: Naphtho(2,3–b)thiophene, Naphtho[2,3-b]thiophene (purified by sublimation), >98.0%(GC), Naphtho[2,3-b]thiophene. Offered by: GLPBio, TCI, Chemat. Available pack sizes: 100mg, 250mg, 1g.
Benzo[f][1]benzothiole (CAS 268-77-9) is a chemical compound with the molecular formula C12H8S and a molecular weight of 184.26 g/mol. IUPAC name: benzo[f][1]benzothiole. InChIKey: CYKIHIBNSFRKQP-UHFFFAOYSA-N.
| Molecular formula | C12H8S |
|---|---|
| Molecular weight | 184.26 g/mol |
| IUPAC name | benzo[f][1]benzothiole |
| InChIKey | CYKIHIBNSFRKQP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C3C(=CC2=C1)C=CS3 |
Computed by PubChem (NCBI)