CAS 33262-29-2 appears in our catalog under these names: Dibenzothiophene-1,2,3,4,6,7,8,9-d8, >95% (HPLC), Dibenzothiophene-d8, 98 atom % D, min 98% Chemical Purity, Dibenzothiophene-d8. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 25mg, 50mg, 5mg, 0,25g, 0,1g, 5 mg.
1,2,3,4,6,7,8,9-octadeuteriodibenzothiophene (CAS 33262-29-2) is a chemical compound with the molecular formula C12H8S and a molecular weight of 192.31 g/mol. IUPAC name: 1,2,3,4,6,7,8,9-octadeuteriodibenzothiophene. InChIKey: IYYZUPMFVPLQIF-PGRXLJNUSA-N.
| Molecular formula | C12H8S |
|---|---|
| Molecular weight | 192.31 g/mol |
| IUPAC name | 1,2,3,4,6,7,8,9-octadeuteriodibenzothiophene |
| InChIKey | IYYZUPMFVPLQIF-PGRXLJNUSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C3=C(C(=C(C(=C3S2)[2H])[2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)