Products 2680605-58-5
CAS 2680605-58-5 is the registry number for tert-Butyl (trifluoromethyl)-L-phenylalaninate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 2-amino-3-[2-(trifluoromethyl)-4-pyridinyl]propanoate (CAS 2680605-58-5) is a chemical compound with the molecular formula C13H17F3N2O2 and a molecular weight of 290.28 g/mol. IUPAC name: tert-butyl 2-amino-3-[2-(trifluoromethyl)-4-pyridinyl]propanoate. InChIKey: VJJYEDILXDEOLD-UHFFFAOYSA-N.
| Molecular formula | C13H17F3N2O2 |
|---|---|
| Molecular weight | 290.28 g/mol |
| IUPAC name | tert-butyl 2-amino-3-[2-(trifluoromethyl)-4-pyridinyl]propanoate |
| InChIKey | VJJYEDILXDEOLD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C(CC1=CC(=NC=C1)C(F)(F)F)N |
Computed by PubChem (NCBI)