CAS 693249-72-8 appears in our catalog under these names: tert-Butyl N-{(3-amino-5-(trifluoromethyl)phenyl)methyl}carbamate, tert-Butyl (3-amino-5-(trifluoromethyl)benzyl)carbamate, 95%. Offered by: Biosynth, Fluorochem, Ambeed. Available pack sizes: 50mg, 0,5g, 100mg, 1g, 250mg.
Tert-butyl N-[[3-amino-5-(trifluoromethyl)phenyl]methyl]carbamate (CAS 693249-72-8) is a chemical compound with the molecular formula C13H17F3N2O2 and a molecular weight of 290.28 g/mol. IUPAC name: tert-butyl N-[[3-amino-5-(trifluoromethyl)phenyl]methyl]carbamate. InChIKey: ITVMQUIBGJIBMO-UHFFFAOYSA-N.
| Molecular formula | C13H17F3N2O2 |
|---|---|
| Molecular weight | 290.28 g/mol |
| IUPAC name | tert-butyl N-[[3-amino-5-(trifluoromethyl)phenyl]methyl]carbamate |
| InChIKey | ITVMQUIBGJIBMO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=CC(=CC(=C1)N)C(F)(F)F |
Computed by PubChem (NCBI)