Products 2680607-37-6
CAS 2680607-37-6 appears in our catalog under these names: Fmoc-(S)-2-Amino-3-(5,6-dimethoxypyridin-3-yl)propanoic acid, 95%, FMOC-L-3PY56DOME-OH, NOVABIOCHEM(R). Offered by: Chemat Brand, Sigma-Aldrich. Available pack sizes: on request, 500MG.
(2S)-3-(5,6-dimethoxy-3-pyridinyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 2680607-37-6) is a chemical compound with the molecular formula C25H24N2O6 and a molecular weight of 448.5 g/mol. IUPAC name: (2S)-3-(5,6-dimethoxy-3-pyridinyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: MICLJYIGDFJBCO-NRFANRHFSA-N.
| Molecular formula | C25H24N2O6 |
|---|---|
| Molecular weight | 448.5 g/mol |
| IUPAC name | (2S)-3-(5,6-dimethoxy-3-pyridinyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | MICLJYIGDFJBCO-NRFANRHFSA-N |
| SMILES | COC1=C(N=CC(=C1)C[C@@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)OC |
Computed by PubChem (NCBI)