CAS 99522-79-9 appears in our catalog under these names: Pranidipine, 95%, Pranidipine, Pranidipine/ 99.89% (existing batch purity), Pranidipine 99%, Pranidipine, 99%, 99%. Offered by: Combi-blocks, TRC, TargetMol, GLPBio, Ambeed. Available pack sizes: 100mg, 10mg, 1mg, 2mg, 5mg, 25mg, 50mg, 250mg.
3-O-methyl 5-O-[(E)-3-phenylprop-2-enyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (CAS 99522-79-9) is a chemical compound with the molecular formula C25H24N2O6 and a molecular weight of 448.5 g/mol. IUPAC name: 3-O-methyl 5-O-[(E)-3-phenylprop-2-enyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate. InChIKey: XTFPDGZNWTZCMF-DHZHZOJOSA-N.
| Molecular formula | C25H24N2O6 |
|---|---|
| Molecular weight | 448.5 g/mol |
| IUPAC name | 3-O-methyl 5-O-[(E)-3-phenylprop-2-enyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| InChIKey | XTFPDGZNWTZCMF-DHZHZOJOSA-N |
| SMILES | CC1=C(C(C(=C(N1)C)C(=O)OC/C=C/C2=CC=CC=C2)C3=CC(=CC=C3)[N+](=O)[O-])C(=O)OC |
Computed by PubChem (NCBI)