CAS 2680608-97-1 is the registry number for Propofol Impurity 18. Offered by: Chemat Brand. Available pack sizes: on request.
4-hydroxy-3-propan-2-yl-5-propylbenzoic acid (CAS 2680608-97-1) is a chemical compound with the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. IUPAC name: 4-hydroxy-3-propan-2-yl-5-propylbenzoic acid. InChIKey: AFAZIFHOBVSZHF-UHFFFAOYSA-N.
| Molecular formula | C13H18O3 |
|---|---|
| Molecular weight | 222.28 g/mol |
| IUPAC name | 4-hydroxy-3-propan-2-yl-5-propylbenzoic acid |
| InChIKey | AFAZIFHOBVSZHF-UHFFFAOYSA-N |
| SMILES | CCCC1=C(C(=CC(=C1)C(=O)O)C(C)C)O |
Computed by PubChem (NCBI)