Products 2680659-45-2

CAS 2680659-45-2 is the registry number for rel-3-((1S,3s)-3-(((allyloxy)carbonyl)amino)cyclobutyl)propiolic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-[3-(prop-2-enoxycarbonylamino)cyclobutyl]prop-2-ynoic acid (CAS 2680659-45-2) is a chemical compound with the molecular formula C11H13NO4 and a molecular weight of 223.22 g/mol. IUPAC name: 3-[3-(prop-2-enoxycarbonylamino)cyclobutyl]prop-2-ynoic acid. InChIKey: IALHZADMTRIMHJ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13NO4
Molecular weight223.22 g/mol
IUPAC name3-[3-(prop-2-enoxycarbonylamino)cyclobutyl]prop-2-ynoic acid
InChIKeyIALHZADMTRIMHJ-UHFFFAOYSA-N
SMILESC=CCOC(=O)NC1CC(C1)C#CC(=O)O

Computed by PubChem (NCBI)