Products 2680789-55-1

CAS 2680789-55-1 is the registry number for tert-Butyl (3-bromo-1-methyl-1H-pyrazol-4-yl)carbamate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.

Structural formula: {0} (CAS {1})

Tert-butyl N-(3-bromo-1-methylpyrazol-4-yl)carbamate (CAS 2680789-55-1) is a chemical compound with the molecular formula C9H14BrN3O2 and a molecular weight of 276.13 g/mol. IUPAC name: tert-butyl N-(3-bromo-1-methylpyrazol-4-yl)carbamate. InChIKey: FNQRMPKUTXOTAW-UHFFFAOYSA-N.

Identity
Molecular formulaC9H14BrN3O2
Molecular weight276.13 g/mol
IUPAC nametert-butyl N-(3-bromo-1-methylpyrazol-4-yl)carbamate
InChIKeyFNQRMPKUTXOTAW-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC1=CN(N=C1Br)C

Computed by PubChem (NCBI)