CAS 565210-78-8 appears in our catalog under these names: 6-Amino-5-bromo-1-butyl-3-methyl-1,2,3,4-tetrahydropyrimidine-2,4-dione, 98%, 6-Amino-5-bromo-1-butyl-3-methylpyrimidine-2,4(1H,3H)-dione, 98%. Offered by: AmBeed. Available pack sizes: 100mg, 10g, 250mg, 1g, 5g.
6-amino-5-bromo-1-butyl-3-methylpyrimidine-2,4-dione (CAS 565210-78-8) is a chemical compound with the molecular formula C9H14BrN3O2 and a molecular weight of 276.13 g/mol. IUPAC name: 6-amino-5-bromo-1-butyl-3-methylpyrimidine-2,4-dione. InChIKey: IMRVSQKFBBWMCL-UHFFFAOYSA-N.
| Molecular formula | C9H14BrN3O2 |
|---|---|
| Molecular weight | 276.13 g/mol |
| IUPAC name | 6-amino-5-bromo-1-butyl-3-methylpyrimidine-2,4-dione |
| InChIKey | IMRVSQKFBBWMCL-UHFFFAOYSA-N |
| SMILES | CCCCN1C(=C(C(=O)N(C1=O)C)Br)N |
Computed by PubChem (NCBI)